C15H17ClO4 — CID 69387596
[4-(4-chloro-2-oxobutanoyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 69387596) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is [4-(4-chloro-2-oxobutanoyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-chloro-2-oxobutanoyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 69387596 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [4-(4-chloro-2-oxobutanoyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(=O)C(=O)CCCl)cc1 |
| InChI | InChI=1S/C15H17ClO4/c1-15(2,3)14(19)20-11-6-4-10(5-7-11)13(18)12(17)8-9-16/h4-7H,8-9H2,1-3H3 |
| InChIKey | WBIRFNJKOIZUTC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|