C13H15ClO4 — CID 59081476
[4-(carbonochloridoyloxymethyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 59081476) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is [4-(carbonochloridoyloxymethyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(carbonochloridoyloxymethyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59081476 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [4-(carbonochloridoyloxymethyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(COC(=O)Cl)cc1 |
| InChI | InChI=1S/C13H15ClO4/c1-13(2,3)11(15)18-10-6-4-9(5-7-10)8-17-12(14)16/h4-7H,8H2,1-3H3 |
| InChIKey | ATZCDTBBDBWIAE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|