C16H20O4 — CID 118427002
[4-(but-3-ynylperoxymethyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 118427002) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [4-(but-3-ynylperoxymethyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(but-3-ynylperoxymethyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118427002 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [4-(but-3-ynylperoxymethyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | C#CCCOOCc1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H20O4/c1-5-6-11-18-19-12-13-7-9-14(10-8-13)20-15(17)16(2,3)4/h1,7-10H,6,11-12H2,2-4H3 |
| InChIKey | XXOVXACOOGWSGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|