C15H20O7P- — CID 10246815
[4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-(2-methoxy-2-oxoethyl)phosphinate (PubChem CID 10246815) has the molecular formula C15H20O7P- and a molecular weight of 343.29 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-(2-methoxy-2-oxoethyl)phosphinate.
| Compound Name | [4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-(2-methoxy-2-oxoethyl)phosphinate |
|---|---|
| PubChem CID | 10246815 |
| Molecular Formula | C15H20O7P- |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-(2-methoxy-2-oxoethyl)phosphinate |
| SMILES | COC(=O)CP(=O)([O-])OCc1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21O7P/c1-15(2,3)14(17)22-12-7-5-11(6-8-12)9-21-23(18,19)10-13(16)20-4/h5-8H,9-10H2,1-4H3,(H,18,19)/p-1 |
| InChIKey | MJLXBQGZERKNRJ-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|