C10H13O5P — CID 14959132
(4-acetyloxyphenyl)methoxy-methylphosphinic acid (PubChem CID 14959132) has the molecular formula C10H13O5P and a molecular weight of 244.18 g/mol. Its IUPAC name is (4-acetyloxyphenyl)methoxy-methylphosphinic acid.
| Compound Name | (4-acetyloxyphenyl)methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 14959132 |
| Molecular Formula | C10H13O5P |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (4-acetyloxyphenyl)methoxy-methylphosphinic acid |
| SMILES | CC(=O)Oc1ccc(COP(C)(=O)O)cc1 |
| InChI | InChI=1S/C10H13O5P/c1-8(11)15-10-5-3-9(4-6-10)7-14-16(2,12)13/h3-6H,7H2,1-2H3,(H,12,13) |
| InChIKey | HFASAUFBNGLKDO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|