About (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate
(4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate (PubChem CID 158634660) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate.
Molecular Properties
| Compound Name | (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate |
| PubChem CID | 158634660 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate |
| SMILES | C=Cc1ccc(COC(C)=O)cc1.C=Cc1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C11H12O2.C10H10O2/c1-3-10-4-6-11(7-5-10)8-13-9(2)12;1-3-9-4-6-10(7-5-9)12-8(2)11/h3-7H,1,8H2,2H3;3-7H,1H2,2H3 |
| InChIKey | HZPUQIMFDUEHSK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate?
The IUPAC name of (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate (CID 158634660) is (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate.
What is the SMILES notation for (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate?
The canonical SMILES for (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate is C=Cc1ccc(COC(C)=O)cc1.C=Cc1ccc(OC(C)=O)cc1.
What is the InChIKey of (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate?
The InChIKey is HZPUQIMFDUEHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C10H10O2/c1-3-10-4-6-11(7-5-10)8-13-9(2)12;1-3-9-4-6-10(7-5-9)12-8(2)11/h3-7H,1,8H2,2H3;3-7H,1H2,2H3.
What are the key properties of (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate?
(4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate has a molecular weight of 338.40 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl) acetate;(4-ethenylphenyl)methyl acetate is sourced from PubChem (CID 158634660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).