C19H18O5 — CID 122625881
(4-ethenylphenyl)methyl 4-ethoxycarbonyloxybenzoate (PubChem CID 122625881) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 4-ethoxycarbonyloxybenzoate.
| Compound Name | (4-ethenylphenyl)methyl 4-ethoxycarbonyloxybenzoate |
|---|---|
| PubChem CID | 122625881 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (4-ethenylphenyl)methyl 4-ethoxycarbonyloxybenzoate |
| SMILES | C=Cc1ccc(COC(=O)c2ccc(OC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C19H18O5/c1-3-14-5-7-15(8-6-14)13-23-18(20)16-9-11-17(12-10-16)24-19(21)22-4-2/h3,5-12H,1,4,13H2,2H3 |
| InChIKey | CDYHEULPVXNEAN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|