C52H62O8 — CID 101405378
(4-ethenylphenyl)methyl 3,4,5-tris[[4-[(2R)-2-methylbutoxy]phenyl]methoxy]benzoate (PubChem CID 101405378) has the molecular formula C52H62O8 and a molecular weight of 815.06 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 3,4,5-tris[[4-[(2R)-2-methylbutoxy]phenyl]methoxy]benzoate.
| Compound Name | (4-ethenylphenyl)methyl 3,4,5-tris[[4-[(2R)-2-methylbutoxy]phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 101405378 |
| Molecular Formula | C52H62O8 |
| Molecular Weight | 815.06 g/mol |
| Exact Mass | 814.44 |
| IUPAC Name | (4-ethenylphenyl)methyl 3,4,5-tris[[4-[(2R)-2-methylbutoxy]phenyl]methoxy]benzoate |
| SMILES | C=Cc1ccc(COC(=O)c2cc(OCc3ccc(OC[C@H](C)CC)cc3)c(OCc3ccc(OC[C@H](C)CC)cc3)c(OCc3ccc(OC[C@H](C)CC)cc3)c2)cc1 |
| InChI | InChI=1S/C52H62O8/c1-8-37(5)30-54-46-22-16-42(17-23-46)33-57-49-28-45(52(53)60-36-41-14-12-40(11-4)13-15-41)29-50(58-34-43-18-24-47(25-19-43)55-31-38(6)9-2)51(49)59-35-44-20-26-48(27-21-44)56-32-39(7)10-3/h11-29,37-39H,4,8-10,30-36H2,1-3,5-7H3/t37-,38-,39-/m1/s1 |
| InChIKey | KVRNRUBFQQDVDM-CCUSMBMVSA-N |
| XLogP | 12.70 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.06 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |