C25H25NO6 — CID 90127421
6-amino-2-ethenyl-3,4-bis[(4-methoxyphenyl)methoxy]benzoic acid (PubChem CID 90127421) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 6-amino-2-ethenyl-3,4-bis[(4-methoxyphenyl)methoxy]benzoic acid.
| Compound Name | 6-amino-2-ethenyl-3,4-bis[(4-methoxyphenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 90127421 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 6-amino-2-ethenyl-3,4-bis[(4-methoxyphenyl)methoxy]benzoic acid |
| SMILES | C=Cc1c(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)cc(N)c1C(=O)O |
| InChI | InChI=1S/C25H25NO6/c1-4-20-23(25(27)28)21(26)13-22(31-14-16-5-9-18(29-2)10-6-16)24(20)32-15-17-7-11-19(30-3)12-8-17/h4-13H,1,14-15,26H2,2-3H3,(H,27,28) |
| InChIKey | MLIVSDQUXVHENG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|