C28H27ClN2O5 — CID 90127502
3-(2-chloroethyl)-5-ethenyl-6,7-bis[(4-methoxyphenyl)methoxy]quinazolin-4-one (PubChem CID 90127502) has the molecular formula C28H27ClN2O5 and a molecular weight of 506.99 g/mol. Its IUPAC name is 3-(2-chloroethyl)-5-ethenyl-6,7-bis[(4-methoxyphenyl)methoxy]quinazolin-4-one.
| Compound Name | 3-(2-chloroethyl)-5-ethenyl-6,7-bis[(4-methoxyphenyl)methoxy]quinazolin-4-one |
|---|---|
| PubChem CID | 90127502 |
| Molecular Formula | C28H27ClN2O5 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 3-(2-chloroethyl)-5-ethenyl-6,7-bis[(4-methoxyphenyl)methoxy]quinazolin-4-one |
| SMILES | C=Cc1c(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)cc2ncn(CCCl)c(=O)c12 |
| InChI | InChI=1S/C28H27ClN2O5/c1-4-23-26-24(30-18-31(14-13-29)28(26)32)15-25(35-16-19-5-9-21(33-2)10-6-19)27(23)36-17-20-7-11-22(34-3)12-8-20/h4-12,15,18H,1,13-14,16-17H2,2-3H3 |
| InChIKey | ZILMJPKAXMCCRY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|