About 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole
5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole (PubChem CID 68710313) has the molecular formula C21H20Cl2N2O3
and a molecular weight of 419.31 g/mol. Its IUPAC name is 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole |
| PubChem CID | 68710313 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole |
| SMILES | C=Cc1c(C)nn(C)c1Oc1cc(OCc2ccc(OC)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-5-16-13(2)24-25(3)21(16)28-20-11-19(17(22)10-18(20)23)27-12-14-6-8-15(26-4)9-7-14/h5-11H,1,12H2,2-4H3 |
| InChIKey | XWCRGBXETOGZDL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole?
The IUPAC name of 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole (CID 68710313) is 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole.
What is the SMILES notation for 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole?
The canonical SMILES for 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole is C=Cc1c(C)nn(C)c1Oc1cc(OCc2ccc(OC)cc2)c(Cl)cc1Cl.
What is the InChIKey of 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole?
The InChIKey is XWCRGBXETOGZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N2O3/c1-5-16-13(2)24-25(3)21(16)28-20-11-19(17(22)10-18(20)23)27-12-14-6-8-15(26-4)9-7-14/h5-11H,1,12H2,2-4H3.
What are the key properties of 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole?
5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole has a molecular weight of 419.31 g/mol, XLogP of 6.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1,3-dimethylpyrazole is sourced from PubChem (CID 68710313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).