C16H16Cl2N2O5 — CID 86638231
methyl (2S)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]propanoate (PubChem CID 86638231) has the molecular formula C16H16Cl2N2O5 and a molecular weight of 387.22 g/mol. Its IUPAC name is methyl (2S)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]propanoate.
| Compound Name | methyl (2S)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 86638231 |
| Molecular Formula | C16H16Cl2N2O5 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | methyl (2S)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1cc(Oc2c(C=O)c(C)nn2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O5/c1-8-10(7-21)15(20(3)19-8)25-14-6-13(11(17)5-12(14)18)24-9(2)16(22)23-4/h5-7,9H,1-4H3/t9-/m0/s1 |
| InChIKey | QZLLCEIGPRCKQU-VIFPVBQESA-N |
| XLogP | 3.58 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|