C16H18Cl2N4O5 — CID 86638269
methyl (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoate (PubChem CID 86638269) has the molecular formula C16H18Cl2N4O5 and a molecular weight of 417.25 g/mol. Its IUPAC name is methyl (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoate.
| Compound Name | methyl (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 86638269 |
| Molecular Formula | C16H18Cl2N4O5 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | methyl (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1cc(Oc2c(C(=O)NN)c(C)nn2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N4O5/c1-7-13(14(23)20-19)15(22(3)21-7)27-12-6-11(9(17)5-10(12)18)26-8(2)16(24)25-4/h5-6,8H,19H2,1-4H3,(H,20,23)/t8-/m0/s1 |
| InChIKey | HJWOCIDXACIBSO-QMMMGPOBSA-N |
| XLogP | 2.37 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|