C15H16Cl2N4O5 — CID 68711592
(2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid (PubChem CID 68711592) has the molecular formula C15H16Cl2N4O5 and a molecular weight of 403.22 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 68711592 |
| Molecular Formula | C15H16Cl2N4O5 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-[4-(hydrazinecarbonyl)-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
| SMILES | Cc1nn(C)c(Oc2cc(O[C@@H](C)C(=O)O)c(Cl)cc2Cl)c1C(=O)NN |
| InChI | InChI=1S/C15H16Cl2N4O5/c1-6-12(13(22)19-18)14(21(3)20-6)26-11-5-10(8(16)4-9(11)17)25-7(2)15(23)24/h4-5,7H,18H2,1-3H3,(H,19,22)(H,23,24)/t7-/m0/s1 |
| InChIKey | NGNIVCZNJYXTDL-ZETCQYMHSA-N |
| XLogP | 2.28 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|