C16H17Cl2N3O5 — CID 87545132
(2S)-2-[2,4-dichloro-5-[4-[(E)-methoxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid (PubChem CID 87545132) has the molecular formula C16H17Cl2N3O5 and a molecular weight of 402.23 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-[4-[(E)-methoxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,4-dichloro-5-[4-[(E)-methoxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 87545132 |
| Molecular Formula | C16H17Cl2N3O5 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-[4-[(E)-methoxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
| SMILES | CO/N=C/c1c(C)nn(C)c1Oc1cc(O[C@@H](C)C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O5/c1-8-10(7-19-24-4)15(21(3)20-8)26-14-6-13(11(17)5-12(14)18)25-9(2)16(22)23/h5-7,9H,1-4H3,(H,22,23)/b19-7+/t9-/m0/s1 |
| InChIKey | XPUXTXVCSHPHSH-YIFSTYHKSA-N |
| XLogP | 3.66 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|