C18H19Cl2N3O6 — CID 173103794
(2S)-2-[2,4-dichloro-5-[1,3-dimethyl-4-(2-oxopropoxyiminomethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid (PubChem CID 173103794) has the molecular formula C18H19Cl2N3O6 and a molecular weight of 444.27 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-[1,3-dimethyl-4-(2-oxopropoxyiminomethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,4-dichloro-5-[1,3-dimethyl-4-(2-oxopropoxyiminomethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 173103794 |
| Molecular Formula | C18H19Cl2N3O6 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-[1,3-dimethyl-4-(2-oxopropoxyiminomethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid |
| SMILES | CC(=O)CON=Cc1c(C)nn(C)c1Oc1cc(O[C@@H](C)C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O6/c1-9(24)8-27-21-7-12-10(2)22-23(4)17(12)29-16-6-15(13(19)5-14(16)20)28-11(3)18(25)26/h5-7,11H,8H2,1-4H3,(H,25,26)/t11-/m0/s1 |
| InChIKey | OMIGNKLTRIMIHP-NSHDSACASA-N |
| XLogP | 3.62 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|