C15H15Cl2N3O5 — CID 87545001
(2S)-2-[2,4-dichloro-5-[4-[(E)-hydroxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid (PubChem CID 87545001) has the molecular formula C15H15Cl2N3O5 and a molecular weight of 388.21 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-[4-[(E)-hydroxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,4-dichloro-5-[4-[(E)-hydroxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 87545001 |
| Molecular Formula | C15H15Cl2N3O5 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-[4-[(E)-hydroxyiminomethyl]-1,3-dimethylpyrazol-5-yl]oxyphenoxy]propanoic acid |
| SMILES | Cc1nn(C)c(Oc2cc(O[C@@H](C)C(=O)O)c(Cl)cc2Cl)c1/C=N/O |
| InChI | InChI=1S/C15H15Cl2N3O5/c1-7-9(6-18-23)14(20(3)19-7)25-13-5-12(10(16)4-11(13)17)24-8(2)15(21)22/h4-6,8,23H,1-3H3,(H,21,22)/b18-6+/t8-/m0/s1 |
| InChIKey | NRVGLCLFZQHMIX-XXSJOENDSA-N |
| XLogP | 3.49 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|