C15H13Cl2N3O5 — CID 91563626
methyl 2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyanilino]-2-oxoacetate (PubChem CID 91563626) has the molecular formula C15H13Cl2N3O5 and a molecular weight of 386.19 g/mol. Its IUPAC name is methyl 2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyanilino]-2-oxoacetate.
| Compound Name | methyl 2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 91563626 |
| Molecular Formula | C15H13Cl2N3O5 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | methyl 2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)oxyanilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(Oc2c(C=O)c(C)nn2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O5/c1-7-8(6-21)14(20(2)19-7)25-12-5-11(9(16)4-10(12)17)18-13(22)15(23)24-3/h4-6H,1-3H3,(H,18,22) |
| InChIKey | FYCSABBRBPZTQU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|