C23H23Cl2N3O5 — CID 86638196
5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 86638196) has the molecular formula C23H23Cl2N3O5 and a molecular weight of 492.36 g/mol. Its IUPAC name is 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86638196 |
| Molecular Formula | C23H23Cl2N3O5 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | C=Cc1c(C(=O)N(C)OC)nn(C)c1Oc1cc(OCc2ccc(OC)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N3O5/c1-6-16-21(22(29)28(3)31-5)26-27(2)23(16)33-20-12-19(17(24)11-18(20)25)32-13-14-7-9-15(30-4)10-8-14/h6-12H,1,13H2,2-5H3 |
| InChIKey | AELLXLBDTZNLHV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|