C25H26ClNO6 — CID 118460229
2-chloro-N-methoxy-3,4-bis[(4-methoxyphenyl)methoxy]-N-methylbenzamide (PubChem CID 118460229) has the molecular formula C25H26ClNO6 and a molecular weight of 471.94 g/mol. Its IUPAC name is 2-chloro-N-methoxy-3,4-bis[(4-methoxyphenyl)methoxy]-N-methylbenzamide.
| Compound Name | 2-chloro-N-methoxy-3,4-bis[(4-methoxyphenyl)methoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 118460229 |
| Molecular Formula | C25H26ClNO6 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-chloro-N-methoxy-3,4-bis[(4-methoxyphenyl)methoxy]-N-methylbenzamide |
| SMILES | COc1ccc(COc2ccc(C(=O)N(C)OC)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H26ClNO6/c1-27(31-4)25(28)21-13-14-22(32-15-17-5-9-19(29-2)10-6-17)24(23(21)26)33-16-18-7-11-20(30-3)12-8-18/h5-14H,15-16H2,1-4H3 |
| InChIKey | LMICPVRJEFBBBE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|