C23H21ClO5 — CID 88918697
2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzaldehyde (PubChem CID 88918697) has the molecular formula C23H21ClO5 and a molecular weight of 412.87 g/mol. Its IUPAC name is 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzaldehyde.
| Compound Name | 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 88918697 |
| Molecular Formula | C23H21ClO5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzaldehyde |
| SMILES | COc1ccc(COc2ccc(C=O)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21ClO5/c1-26-19-8-3-16(4-9-19)14-28-21-12-7-18(13-25)22(24)23(21)29-15-17-5-10-20(27-2)11-6-17/h3-13H,14-15H2,1-2H3 |
| InChIKey | VWSVIHMZILESMM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|