C31H31ClO9 — CID 160853535
9-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2,8,9-trioxononanoic acid (PubChem CID 160853535) has the molecular formula C31H31ClO9 and a molecular weight of 583.03 g/mol. Its IUPAC name is 9-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2,8,9-trioxononanoic acid.
| Compound Name | 9-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2,8,9-trioxononanoic acid |
|---|---|
| PubChem CID | 160853535 |
| Molecular Formula | C31H31ClO9 |
| Molecular Weight | 583.03 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 9-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2,8,9-trioxononanoic acid |
| SMILES | COc1ccc(COc2ccc(C(=O)C(=O)CCCCCC(=O)C(=O)O)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31ClO9/c1-38-22-12-8-20(9-13-22)18-40-27-17-16-24(29(35)25(33)6-4-3-5-7-26(34)31(36)37)28(32)30(27)41-19-21-10-14-23(39-2)15-11-21/h8-17H,3-7,18-19H2,1-2H3,(H,36,37) |
| InChIKey | SJONCZNFNCIJJC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.03 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|