C26H27Cl2N3O8S — CID 139576821
N-[2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]ethylcarbamoyl]sulfamoyl chloride (PubChem CID 139576821) has the molecular formula C26H27Cl2N3O8S and a molecular weight of 612.49 g/mol. Its IUPAC name is N-[2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]ethylcarbamoyl]sulfamoyl chloride.
| Compound Name | N-[2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]ethylcarbamoyl]sulfamoyl chloride |
|---|---|
| PubChem CID | 139576821 |
| Molecular Formula | C26H27Cl2N3O8S |
| Molecular Weight | 612.49 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | N-[2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]ethylcarbamoyl]sulfamoyl chloride |
| SMILES | COc1ccc(COc2ccc(C(=O)NCCNC(=O)NS(=O)(=O)Cl)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H27Cl2N3O8S/c1-36-19-7-3-17(4-8-19)15-38-22-12-11-21(25(32)29-13-14-30-26(33)31-40(28,34)35)23(27)24(22)39-16-18-5-9-20(37-2)10-6-18/h3-12H,13-16H2,1-2H3,(H,29,32)(H2,30,31,33) |
| InChIKey | MJJHDRNGQCHCNW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|