C33H32ClN5O6S — CID 167171402
2-[1-[3-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]propyl]pyrazol-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 167171402) has the molecular formula C33H32ClN5O6S and a molecular weight of 662.17 g/mol. Its IUPAC name is 2-[1-[3-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]propyl]pyrazol-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[1-[3-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]propyl]pyrazol-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167171402 |
| Molecular Formula | C33H32ClN5O6S |
| Molecular Weight | 662.17 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | 2-[1-[3-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]amino]propyl]pyrazol-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(COc2ccc(C(=O)NCCCn3cc(-c4ncc(C(N)=O)s4)cn3)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H32ClN5O6S/c1-42-24-8-4-21(5-9-24)19-44-27-13-12-26(29(34)30(27)45-20-22-6-10-25(43-2)11-7-22)32(41)36-14-3-15-39-18-23(16-38-39)33-37-17-28(46-33)31(35)40/h4-13,16-18H,3,14-15,19-20H2,1-2H3,(H2,35,40)(H,36,41) |
| InChIKey | WBYWKDHSEVEMFH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.17 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|