C32H35ClN2O6 — CID 90127260
N-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetamide (PubChem CID 90127260) has the molecular formula C32H35ClN2O6 and a molecular weight of 579.09 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 90127260 |
| Molecular Formula | C32H35ClN2O6 |
| Molecular Weight | 579.09 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetamide |
| SMILES | COc1ccc(COc2ccc(C(=O)C(=O)NCC34CCN(CC3)CC4)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H35ClN2O6/c1-38-24-7-3-22(4-8-24)19-40-27-12-11-26(28(33)30(27)41-20-23-5-9-25(39-2)10-6-23)29(36)31(37)34-21-32-13-16-35(17-14-32)18-15-32/h3-12H,13-21H2,1-2H3,(H,34,37) |
| InChIKey | JDZYSHLJXWMONI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|