C32H34N2O6 — CID 90127616
2-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-4,5-bis[(4-methoxyphenyl)methoxy]isoindole-1,3-dione (PubChem CID 90127616) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-4,5-bis[(4-methoxyphenyl)methoxy]isoindole-1,3-dione.
| Compound Name | 2-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-4,5-bis[(4-methoxyphenyl)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90127616 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-(1-azabicyclo[2.2.2]octan-4-ylmethyl)-4,5-bis[(4-methoxyphenyl)methoxy]isoindole-1,3-dione |
| SMILES | COc1ccc(COc2ccc3c(c2OCc2ccc(OC)cc2)C(=O)N(CC24CCN(CC2)CC4)C3=O)cc1 |
| InChI | InChI=1S/C32H34N2O6/c1-37-24-7-3-22(4-8-24)19-39-27-12-11-26-28(29(27)40-20-23-5-9-25(38-2)10-6-23)31(36)34(30(26)35)21-32-13-16-33(17-14-32)18-15-32/h3-12H,13-21H2,1-2H3 |
| InChIKey | ZYAKJRFXNKMUAP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|