C31H34N2O6 — CID 90127345
4,5-bis[(4-methoxyphenyl)methoxy]-2-(2-piperidin-1-ylethyl)isoindole-1,3-dione (PubChem CID 90127345) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is 4,5-bis[(4-methoxyphenyl)methoxy]-2-(2-piperidin-1-ylethyl)isoindole-1,3-dione.
| Compound Name | 4,5-bis[(4-methoxyphenyl)methoxy]-2-(2-piperidin-1-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 90127345 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 4,5-bis[(4-methoxyphenyl)methoxy]-2-(2-piperidin-1-ylethyl)isoindole-1,3-dione |
| SMILES | COc1ccc(COc2ccc3c(c2OCc2ccc(OC)cc2)C(=O)N(CCN2CCCCC2)C3=O)cc1 |
| InChI | InChI=1S/C31H34N2O6/c1-36-24-10-6-22(7-11-24)20-38-27-15-14-26-28(29(27)39-21-23-8-12-25(37-2)13-9-23)31(35)33(30(26)34)19-18-32-16-4-3-5-17-32/h6-15H,3-5,16-21H2,1-2H3 |
| InChIKey | APZOGKOPLMOHSU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|