C23H27BO6 — CID 156870862
7-[(4-methoxyphenyl)methoxy]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrochromen-4-one (PubChem CID 156870862) has the molecular formula C23H27BO6 and a molecular weight of 410.28 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methoxy]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 7-[(4-methoxyphenyl)methoxy]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 156870862 |
| Molecular Formula | C23H27BO6 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 7-[(4-methoxyphenyl)methoxy]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(COc2ccc3c(c2B2OC(C)(C)C(C)(C)O2)OCCC3=O)cc1 |
| InChI | InChI=1S/C23H27BO6/c1-22(2)23(3,4)30-24(29-22)20-19(11-10-17-18(25)12-13-27-21(17)20)28-14-15-6-8-16(26-5)9-7-15/h6-11H,12-14H2,1-5H3 |
| InChIKey | QFUDETQYZYZIPS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|