C21H29BN2O4 — CID 162533057
2-[(4-methoxyphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 162533057) has the molecular formula C21H29BN2O4 and a molecular weight of 384.29 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
| Compound Name | 2-[(4-methoxyphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
|---|---|
| PubChem CID | 162533057 |
| Molecular Formula | C21H29BN2O4 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | COc1ccc(COCc2nn3c(c2B2OC(C)(C)C(C)(C)O2)CCC3)cc1 |
| InChI | InChI=1S/C21H29BN2O4/c1-20(2)21(3,4)28-22(27-20)19-17(23-24-12-6-7-18(19)24)14-26-13-15-8-10-16(25-5)11-9-15/h8-11H,6-7,12-14H2,1-5H3 |
| InChIKey | JGYBPMOKVZPCNP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|