C20H26BNO5S — CID 58696166
4-methoxy-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 58696166) has the molecular formula C20H26BNO5S and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-methoxy-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58696166 |
| Molecular Formula | C20H26BNO5S |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-methoxy-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C20H26BNO5S/c1-19(2)20(3,4)27-21(26-19)16-8-6-15(7-9-16)14-22-28(23,24)18-12-10-17(25-5)11-13-18/h6-13,22H,14H2,1-5H3 |
| InChIKey | WDKDBGMUEUGUDL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|