C15H24BNO4S2 — CID 143499221
N-(2-methylsulfanylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 143499221) has the molecular formula C15H24BNO4S2 and a molecular weight of 357.31 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-(2-methylsulfanylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 143499221 |
| Molecular Formula | C15H24BNO4S2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-(2-methylsulfanylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CSCCNS(=O)(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H24BNO4S2/c1-14(2)15(3,4)21-16(20-14)12-6-8-13(9-7-12)23(18,19)17-10-11-22-5/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | GCLLSKAEZIZGQW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|