C16H26BNO6S2 — CID 68634509
N-[(3S)-1,1-dihydroxythiolan-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 68634509) has the molecular formula C16H26BNO6S2 and a molecular weight of 403.33 g/mol. Its IUPAC name is N-[(3S)-1,1-dihydroxythiolan-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-[(3S)-1,1-dihydroxythiolan-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 68634509 |
| Molecular Formula | C16H26BNO6S2 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[(3S)-1,1-dihydroxythiolan-3-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)N[C@H]3CCS(O)(O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H26BNO6S2/c1-15(2)16(3,4)24-17(23-15)12-5-7-14(8-6-12)26(21,22)18-13-9-10-25(19,20)11-13/h5-8,13,18-20H,9-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | JPKAJORXHUDUBP-ZDUSSCGKSA-N |
| XLogP | 1.79 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|