C21H31BO6S — CID 147224499
2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 147224499) has the molecular formula C21H31BO6S and a molecular weight of 422.35 g/mol. Its IUPAC name is 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 147224499 |
| Molecular Formula | C21H31BO6S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)CC3CCC4(CC3)OCCO4)cc2)OC1(C)C |
| InChI | InChI=1S/C21H31BO6S/c1-19(2)20(3,4)28-22(27-19)17-5-7-18(8-6-17)29(23,24)15-16-9-11-21(12-10-16)25-13-14-26-21/h5-8,16H,9-15H2,1-4H3 |
| InChIKey | CHSDVIHGMKWVPG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|