C18H23BO4 — CID 135078656
2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentane-1,3-dione (PubChem CID 135078656) has the molecular formula C18H23BO4 and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentane-1,3-dione.
| Compound Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 135078656 |
| Molecular Formula | C18H23BO4 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentane-1,3-dione |
| SMILES | CC1(C)OB(c2ccc(CC3C(=O)CCC3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H23BO4/c1-17(2)18(3,4)23-19(22-17)13-7-5-12(6-8-13)11-14-15(20)9-10-16(14)21/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | BPROIOBTCAGFNM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|