C15H24BO2Si — CID 178071001
CID 178071001 (PubChem CID 178071001) has the molecular formula C15H24BO2Si and a molecular weight of 275.25 g/mol.
| Compound Name | CID 178071001 |
|---|---|
| PubChem CID | 178071001 |
| Molecular Formula | C15H24BO2Si |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | — |
| SMILES | C[Si](C)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H24BO2Si/c1-14(2)15(3,4)18-16(17-14)13-9-7-12(8-10-13)11-19(5)6/h7-10H,11H2,1-6H3 |
| InChIKey | PBDHIEXKBIYBIT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|