C37H49B3O6 — CID 175003958
2-[4-[bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 175003958) has the molecular formula C37H49B3O6 and a molecular weight of 622.23 g/mol. Its IUPAC name is 2-[4-[bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175003958 |
| Molecular Formula | C37H49B3O6 |
| Molecular Weight | 622.23 g/mol |
| Exact Mass | 622.38 |
| IUPAC Name | 2-[4-[bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C37H49B3O6/c1-32(2)33(3,4)42-38(41-32)28-19-13-25(14-20-28)31(26-15-21-29(22-16-26)39-43-34(5,6)35(7,8)44-39)27-17-23-30(24-18-27)40-45-36(9,10)37(11,12)46-40/h13-24,31H,1-12H3 |
| InChIKey | IGQIQAMQSPIREB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.23 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|