C16H25BO4S — CID 171875129
4-sulfanyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol (PubChem CID 171875129) has the molecular formula C16H25BO4S and a molecular weight of 324.25 g/mol. Its IUPAC name is 4-sulfanyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol.
| Compound Name | 4-sulfanyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171875129 |
| Molecular Formula | C16H25BO4S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-sulfanyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol |
| SMILES | CC1(C)OB(c2ccc(C(O)C(O)CCS)cc2)OC1(C)C |
| InChI | InChI=1S/C16H25BO4S/c1-15(2)16(3,4)21-17(20-15)12-7-5-11(6-8-12)14(19)13(18)9-10-22/h5-8,13-14,18-19,22H,9-10H2,1-4H3 |
| InChIKey | MZIXGJGFAHOBQJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|