C31H36BNO6 — CID 171887670
9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate (PubChem CID 171887670) has the molecular formula C31H36BNO6 and a molecular weight of 529.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 171887670 |
| Molecular Formula | C31H36BNO6 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
| SMILES | CC1(C)OB(c2ccc(C(O)C(O)CCNC(=O)OCC3c4ccccc4-c4ccccc43)cc2)OC1(C)C |
| InChI | InChI=1S/C31H36BNO6/c1-30(2)31(3,4)39-32(38-30)21-15-13-20(14-16-21)28(35)27(34)17-18-33-29(36)37-19-26-24-11-7-5-9-22(24)23-10-6-8-12-25(23)26/h5-16,26-28,34-35H,17-19H2,1-4H3,(H,33,36) |
| InChIKey | OHVDIARHMPAPOA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|