C29H33BN2O6 — CID 170835212
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate (PubChem CID 170835212) has the molecular formula C29H33BN2O6 and a molecular weight of 516.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate |
|---|---|
| PubChem CID | 170835212 |
| Molecular Formula | C29H33BN2O6 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate |
| SMILES | CC1(C)OB(c2cncc(C(O)C(O)CNC(=O)OCC3c4ccccc4-c4ccccc43)c2)OC1(C)C |
| InChI | InChI=1S/C29H33BN2O6/c1-28(2)29(3,4)38-30(37-28)19-13-18(14-31-15-19)26(34)25(33)16-32-27(35)36-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-15,24-26,33-34H,16-17H2,1-4H3,(H,32,35) |
| InChIKey | ZCQVAVLPWZNWOO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|