C26H25NO5 — CID 170834099
9H-fluoren-9-ylmethyl N-[3-(4-acetylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834099) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-acetylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-acetylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834099 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-acetylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(=O)c1ccc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-16(28)17-10-12-18(13-11-17)25(30)24(29)14-27-26(31)32-15-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-13,23-25,29-30H,14-15H2,1H3,(H,27,31) |
| InChIKey | RRRLLUWYTKVOGA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |