C24H22INO4 — CID 170835442
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(4-iodophenyl)propyl]carbamate (PubChem CID 170835442) has the molecular formula C24H22INO4 and a molecular weight of 515.35 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(4-iodophenyl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(4-iodophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170835442 |
| Molecular Formula | C24H22INO4 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(4-iodophenyl)propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(I)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H22INO4/c25-16-11-9-15(10-12-16)23(28)22(27)13-26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-23,27-28H,13-14H2,(H,26,29) |
| InChIKey | FSWJTDSLIFQOCY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|