C29H26N2O6 — CID 171887620
9H-fluoren-9-ylmethyl N-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171887620) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887620 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc(N2C(=O)C=CC2=O)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H26N2O6/c32-25(28(35)18-9-11-19(12-10-18)31-26(33)13-14-27(31)34)15-16-30-29(36)37-17-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-14,24-25,28,32,35H,15-17H2,(H,30,36) |
| InChIKey | WLHPSEIDGQYHCP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|