C11H17NO2S — CID 171873815
1-(4-amino-3-methylphenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873815) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-(4-amino-3-methylphenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(4-amino-3-methylphenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873815 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-(4-amino-3-methylphenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)CCS)ccc1N |
| InChI | InChI=1S/C11H17NO2S/c1-7-6-8(2-3-9(7)12)11(14)10(13)4-5-15/h2-3,6,10-11,13-15H,4-5,12H2,1H3 |
| InChIKey | VGSBBSGYPAYMAG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|