C10H12BrClO2S — CID 171875179
1-(3-bromo-4-chlorophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171875179) has the molecular formula C10H12BrClO2S and a molecular weight of 311.63 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171875179 |
| Molecular Formula | C10H12BrClO2S |
| Molecular Weight | 311.63 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | OC(CCS)C(O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H12BrClO2S/c11-7-5-6(1-2-8(7)12)10(14)9(13)3-4-15/h1-2,5,9-10,13-15H,3-4H2 |
| InChIKey | HOXKUKKHDJQTKN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|