C10H11Br2ClO2 — CID 171893096
4-bromo-1-(3-bromo-4-chlorophenyl)butane-1,2-diol (PubChem CID 171893096) has the molecular formula C10H11Br2ClO2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-bromo-1-(3-bromo-4-chlorophenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(3-bromo-4-chlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893096 |
| Molecular Formula | C10H11Br2ClO2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 355.88 |
| IUPAC Name | 4-bromo-1-(3-bromo-4-chlorophenyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H11Br2ClO2/c11-4-3-9(14)10(15)6-1-2-8(13)7(12)5-6/h1-2,5,9-10,14-15H,3-4H2 |
| InChIKey | BHDOPBPHYKSPAI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|