C9H10BrCl2NO2 — CID 171891754
4-bromo-1-(5,6-dichloro-3-pyridinyl)butane-1,2-diol (PubChem CID 171891754) has the molecular formula C9H10BrCl2NO2 and a molecular weight of 314.99 g/mol. Its IUPAC name is 4-bromo-1-(5,6-dichloro-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(5,6-dichloro-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891754 |
| Molecular Formula | C9H10BrCl2NO2 |
| Molecular Weight | 314.99 g/mol |
| Exact Mass | 312.93 |
| IUPAC Name | 4-bromo-1-(5,6-dichloro-3-pyridinyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10BrCl2NO2/c10-2-1-7(14)8(15)5-3-6(11)9(12)13-4-5/h3-4,7-8,14-15H,1-2H2 |
| InChIKey | DCWZGBDRGDYQKW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.99 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|