C9H11ClFNO3 — CID 171872046
1-(5-chloro-6-fluoro-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872046) has the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. Its IUPAC name is 1-(5-chloro-6-fluoro-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(5-chloro-6-fluoro-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872046 |
| Molecular Formula | C9H11ClFNO3 |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1-(5-chloro-6-fluoro-3-pyridinyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cnc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H11ClFNO3/c10-6-3-5(4-12-9(6)11)8(15)7(14)1-2-13/h3-4,7-8,13-15H,1-2H2 |
| InChIKey | WEGMOZQOTRYFBP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|