C10H13FO3 — CID 171871723
1-(4-fluorophenyl)butane-1,2,4-triol (PubChem CID 171871723) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is 1-(4-fluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-fluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871723 |
| Molecular Formula | C10H13FO3 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(4-fluorophenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H13FO3/c11-8-3-1-7(2-4-8)10(14)9(13)5-6-12/h1-4,9-10,12-14H,5-6H2 |
| InChIKey | KICRNPXIUULPPK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |