C11H15FO4 — CID 171872202
1-[4-fluoro-3-(hydroxymethyl)phenyl]butane-1,2,4-triol (PubChem CID 171872202) has the molecular formula C11H15FO4 and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-[4-fluoro-3-(hydroxymethyl)phenyl]butane-1,2,4-triol.
| Compound Name | 1-[4-fluoro-3-(hydroxymethyl)phenyl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872202 |
| Molecular Formula | C11H15FO4 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-[4-fluoro-3-(hydroxymethyl)phenyl]butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(F)c(CO)c1 |
| InChI | InChI=1S/C11H15FO4/c12-9-2-1-7(5-8(9)6-14)11(16)10(15)3-4-13/h1-2,5,10-11,13-16H,3-4,6H2 |
| InChIKey | JINYQKGDJNAMCA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |