C10H12F2O3 — CID 171871871
1-(2,5-difluorophenyl)butane-1,2,4-triol (PubChem CID 171871871) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(2,5-difluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871871 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H12F2O3/c11-6-1-2-8(12)7(5-6)10(15)9(14)3-4-13/h1-2,5,9-10,13-15H,3-4H2 |
| InChIKey | CVNRXHKUYMPPAK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |